C37H45N5O3S — CID 4998799
4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 4998799) has the molecular formula C37H45N5O3S and a molecular weight of 639.87 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4998799 |
| Molecular Formula | C37H45N5O3S |
| Molecular Weight | 639.87 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(=O)CCCSc3nnc(Cc4ccccc4)n3-c3ccc(OC)cc3)CC2C)cc1 |
| InChI | InChI=1S/C37H45N5O3S/c1-4-5-7-11-29-15-17-31(18-16-29)36(44)41-24-23-40(27-28(41)2)35(43)14-10-25-46-37-39-38-34(26-30-12-8-6-9-13-30)42(37)32-19-21-33(45-3)22-20-32/h6,8-9,12-13,15-22,28H,4-5,7,10-11,14,23-27H2,1-3H3 |
| InChIKey | CQGZFSCFXCTDDF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.87 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|