C39H41N5O3S — CID 3657542
4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]butan-1-one (PubChem CID 3657542) has the molecular formula C39H41N5O3S and a molecular weight of 659.86 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3657542 |
| Molecular Formula | C39H41N5O3S |
| Molecular Weight | 659.86 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]butan-1-one |
| SMILES | COc1ccc(-n2c(Cc3ccccc3)nnc2SCCCC(=O)N2CCN(C(=O)C(c3ccccc3)c3ccccc3)C(C)C2)cc1 |
| InChI | InChI=1S/C39H41N5O3S/c1-29-28-42(24-25-43(29)38(46)37(31-15-8-4-9-16-31)32-17-10-5-11-18-32)36(45)19-12-26-48-39-41-40-35(27-30-13-6-3-7-14-30)44(39)33-20-22-34(47-2)23-21-33/h3-11,13-18,20-23,29,37H,12,19,24-28H2,1-2H3 |
| InChIKey | QUQAVJAFLPYZGV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.86 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|