C31H32FN5O2S — CID 4037694
4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(4-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one (PubChem CID 4037694) has the molecular formula C31H32FN5O2S and a molecular weight of 557.70 g/mol. Its IUPAC name is 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(4-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(4-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4037694 |
| Molecular Formula | C31H32FN5O2S |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(4-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H32FN5O2S/c1-23-22-35(18-19-36(23)30(39)25-14-16-26(32)17-15-25)29(38)13-8-20-40-31-34-33-28(21-24-9-4-2-5-10-24)37(31)27-11-6-3-7-12-27/h2-7,9-12,14-17,23H,8,13,18-22H2,1H3 |
| InChIKey | SPDVDVPWQCSKCP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|