C39H41N5O2S — CID 3307950
5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]pentan-1-one (PubChem CID 3307950) has the molecular formula C39H41N5O2S and a molecular weight of 643.86 g/mol. Its IUPAC name is 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 3307950 |
| Molecular Formula | C39H41N5O2S |
| Molecular Weight | 643.86 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]pentan-1-one |
| SMILES | CC1CN(C(=O)CCCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CCN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H41N5O2S/c1-30-29-42(25-26-43(30)38(46)37(32-18-8-3-9-19-32)33-20-10-4-11-21-33)36(45)24-14-15-27-47-39-41-40-35(28-31-16-6-2-7-17-31)44(39)34-22-12-5-13-23-34/h2-13,16-23,30,37H,14-15,24-29H2,1H3 |
| InChIKey | HCHGTKWGMBOPCS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.86 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|