C26H29Cl2N5O2S — CID 4022808
4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]butan-1-one (PubChem CID 4022808) has the molecular formula C26H29Cl2N5O2S and a molecular weight of 546.52 g/mol. Its IUPAC name is 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 4022808 |
| Molecular Formula | C26H29Cl2N5O2S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CCN1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C26H29Cl2N5O2S/c1-19-18-31(14-15-32(19)25(35)24(27)28)23(34)13-8-16-36-26-30-29-22(17-20-9-4-2-5-10-20)33(26)21-11-6-3-7-12-21/h2-7,9-12,19,24H,8,13-18H2,1H3 |
| InChIKey | QOAFIXUZAKOTPG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|