C26H31N5O3S — CID 42741916
ethyl 4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]piperazine-1-carboxylate (PubChem CID 42741916) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is ethyl 4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42741916 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | ethyl 4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N5O3S/c1-2-34-26(33)30-17-15-29(16-18-30)24(32)14-9-19-35-25-28-27-23(20-21-10-5-3-6-11-21)31(25)22-12-7-4-8-13-22/h3-8,10-13H,2,9,14-20H2,1H3 |
| InChIKey | VUYCLMPRZBCCFY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|