C24H28N4OS — CID 42730771
4-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 42730771) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 4-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 42730771 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | Cc1ccccc1-n1c(Cc2ccccc2)nnc1SCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C24H28N4OS/c1-19-10-5-6-13-21(19)28-22(18-20-11-3-2-4-12-20)25-26-24(28)30-17-9-14-23(29)27-15-7-8-16-27/h2-6,10-13H,7-9,14-18H2,1H3 |
| InChIKey | KDGZMIBSMFXYLF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|