C33H44N6O2S — CID 3973433
4-[5-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]-N-cyclohexyl-2-methylpiperazine-1-carboxamide (PubChem CID 3973433) has the molecular formula C33H44N6O2S and a molecular weight of 588.82 g/mol. Its IUPAC name is 4-[5-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]-N-cyclohexyl-2-methylpiperazine-1-carboxamide.
| Compound Name | 4-[5-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]-N-cyclohexyl-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 3973433 |
| Molecular Formula | C33H44N6O2S |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | 4-[5-[[5-benzyl-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]-N-cyclohexyl-2-methylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1-n1c(Cc2ccccc2)nnc1SCCCCC(=O)N1CCN(C(=O)NC2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C33H44N6O2S/c1-25-13-9-10-18-29(25)39-30(23-27-14-5-3-6-15-27)35-36-33(39)42-22-12-11-19-31(40)37-20-21-38(26(2)24-37)32(41)34-28-16-7-4-8-17-28/h3,5-6,9-10,13-15,18,26,28H,4,7-8,11-12,16-17,19-24H2,1-2H3,(H,34,41) |
| InChIKey | GPGSOSPIUTYUJK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|