C35H39N5O2S — CID 6180394
5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]pentan-1-one (PubChem CID 6180394) has the molecular formula C35H39N5O2S and a molecular weight of 593.80 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 6180394 |
| Molecular Formula | C35H39N5O2S |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(-n2c(Cc3ccccc3)nnc2SCCCCC(=O)N2CCN(C(=O)/C=C/c3ccccc3)C(C)C2)cc1 |
| InChI | InChI=1S/C35H39N5O2S/c1-27-16-19-31(20-17-27)40-32(25-30-13-7-4-8-14-30)36-37-35(40)43-24-10-9-15-33(41)38-22-23-39(28(2)26-38)34(42)21-18-29-11-5-3-6-12-29/h3-8,11-14,16-21,28H,9-10,15,22-26H2,1-2H3/b21-18+ |
| InChIKey | JPQHBYPRSSFTAT-DYTRJAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|