C32H35N5O4S — CID 3483012
5-[[5-(furan-2-yl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-phenylprop-2-enoyl)piperazin-1-yl]pentan-1-one (PubChem CID 3483012) has the molecular formula C32H35N5O4S and a molecular weight of 585.73 g/mol. Its IUPAC name is 5-[[5-(furan-2-yl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-phenylprop-2-enoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[[5-(furan-2-yl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-phenylprop-2-enoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 3483012 |
| Molecular Formula | C32H35N5O4S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 5-[[5-(furan-2-yl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-phenylprop-2-enoyl)piperazin-1-yl]pentan-1-one |
| SMILES | COc1ccc(-n2c(SCCCCC(=O)N3CCN(C(=O)C=Cc4ccccc4)C(C)C3)nnc2-c2ccco2)cc1 |
| InChI | InChI=1S/C32H35N5O4S/c1-24-23-35(19-20-36(24)30(39)18-13-25-9-4-3-5-10-25)29(38)12-6-7-22-42-32-34-33-31(28-11-8-21-41-28)37(32)26-14-16-27(40-2)17-15-26/h3-5,8-11,13-18,21,24H,6-7,12,19-20,22-23H2,1-2H3 |
| InChIKey | WJWVGZGSAWHDCW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|