C29H37N5O2S — CID 3975567
1-[4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]pentan-1-one (PubChem CID 3975567) has the molecular formula C29H37N5O2S and a molecular weight of 519.72 g/mol. Its IUPAC name is 1-[4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]pentan-1-one.
| Compound Name | 1-[4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 3975567 |
| Molecular Formula | C29H37N5O2S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 1-[4-[4-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CC1C |
| InChI | InChI=1S/C29H37N5O2S/c1-3-4-16-28(36)33-19-18-32(22-23(33)2)27(35)17-11-20-37-29-31-30-26(21-24-12-7-5-8-13-24)34(29)25-14-9-6-10-15-25/h5-10,12-15,23H,3-4,11,16-22H2,1-2H3 |
| InChIKey | AUPWWYGFRQSYOJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|