C26H32N4OS — CID 42741872
5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-methylpiperidin-1-yl)pentan-1-one (PubChem CID 42741872) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-methylpiperidin-1-yl)pentan-1-one.
| Compound Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-methylpiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 42741872 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 5-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-methylpiperidin-1-yl)pentan-1-one |
| SMILES | CC1CCN(C(=O)CCCCSc2nnc(Cc3ccccc3)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4OS/c1-21-15-17-29(18-16-21)25(31)14-8-9-19-32-26-28-27-24(20-22-10-4-2-5-11-22)30(26)23-12-6-3-7-13-23/h2-7,10-13,21H,8-9,14-20H2,1H3 |
| InChIKey | WXPVNFCALHFGLI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|