C30H31Cl2N5O2S — CID 3964699
4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one (PubChem CID 3964699) has the molecular formula C30H31Cl2N5O2S and a molecular weight of 596.58 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3964699 |
| Molecular Formula | C30H31Cl2N5O2S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C30H31Cl2N5O2S/c1-39-27-11-6-5-10-26(27)35-15-17-36(18-16-35)29(38)12-7-19-40-30-34-33-28(20-22-8-3-2-4-9-22)37(30)23-13-14-24(31)25(32)21-23/h2-6,8-11,13-14,21H,7,12,15-20H2,1H3 |
| InChIKey | WWRLBONVLNWGOF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|