C25H31N5O2S — CID 3640937
4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one (PubChem CID 3640937) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3640937 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
| SMILES | CCn1c(SCCCC(=O)N2CCN(c3ccccc3OC)CC2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C25H31N5O2S/c1-3-30-24(20-10-5-4-6-11-20)26-27-25(30)33-19-9-14-23(31)29-17-15-28(16-18-29)21-12-7-8-13-22(21)32-2/h4-8,10-13H,3,9,14-19H2,1-2H3 |
| InChIKey | XOVJWYZLBNRDJJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|