C33H37N5O2S — CID 5112239
1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one (PubChem CID 5112239) has the molecular formula C33H37N5O2S and a molecular weight of 567.76 g/mol. Its IUPAC name is 1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 5112239 |
| Molecular Formula | C33H37N5O2S |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 1-[4-(2,2-diphenylacetyl)-3-methylpiperazin-1-yl]-4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
| SMILES | CCn1c(SCCCC(=O)N2CCN(C(=O)C(c3ccccc3)c3ccccc3)C(C)C2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C33H37N5O2S/c1-3-37-31(28-18-11-6-12-19-28)34-35-33(37)41-23-13-20-29(39)36-21-22-38(25(2)24-36)32(40)30(26-14-7-4-8-15-26)27-16-9-5-10-17-27/h4-12,14-19,25,30H,3,13,20-24H2,1-2H3 |
| InChIKey | JAWACKNGJNBQSG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|