C34H39N5O2S — CID 5195691
1-[4-(4-tert-butylbenzoyl)-3-methylpiperazin-1-yl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one (PubChem CID 5195691) has the molecular formula C34H39N5O2S and a molecular weight of 581.79 g/mol. Its IUPAC name is 1-[4-(4-tert-butylbenzoyl)-3-methylpiperazin-1-yl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-[4-(4-tert-butylbenzoyl)-3-methylpiperazin-1-yl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 5195691 |
| Molecular Formula | C34H39N5O2S |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 1-[4-(4-tert-butylbenzoyl)-3-methylpiperazin-1-yl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc(-c3ccccc3)n2-c2ccccc2)CCN1C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H39N5O2S/c1-25-24-37(21-22-38(25)32(41)27-17-19-28(20-18-27)34(2,3)4)30(40)16-11-23-42-33-36-35-31(26-12-7-5-8-13-26)39(33)29-14-9-6-10-15-29/h5-10,12-15,17-20,25H,11,16,21-24H2,1-4H3 |
| InChIKey | YUWBKZZQUVGSJX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|