C25H28BrN5O2S — CID 42730922
1-[4-(4-bromobenzoyl)-3-methylpiperazin-1-yl]-4-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one (PubChem CID 42730922) has the molecular formula C25H28BrN5O2S and a molecular weight of 542.50 g/mol. Its IUPAC name is 1-[4-(4-bromobenzoyl)-3-methylpiperazin-1-yl]-4-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-[4-(4-bromobenzoyl)-3-methylpiperazin-1-yl]-4-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 42730922 |
| Molecular Formula | C25H28BrN5O2S |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-[4-(4-bromobenzoyl)-3-methylpiperazin-1-yl]-4-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
| SMILES | Cc1nnc(SCCCC(=O)N2CCN(C(=O)c3ccc(Br)cc3)C(C)C2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H28BrN5O2S/c1-18-17-29(14-15-30(18)24(33)20-10-12-21(26)13-11-20)23(32)9-6-16-34-25-28-27-19(2)31(25)22-7-4-3-5-8-22/h3-5,7-8,10-13,18H,6,9,14-17H2,1-2H3 |
| InChIKey | XGLSWLBKWVCKCD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|