C26H30BrN5O2S — CID 42730899
1-[4-(3-bromobenzoyl)-3-methylpiperazin-1-yl]-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one (PubChem CID 42730899) has the molecular formula C26H30BrN5O2S and a molecular weight of 556.53 g/mol. Its IUPAC name is 1-[4-(3-bromobenzoyl)-3-methylpiperazin-1-yl]-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one.
| Compound Name | 1-[4-(3-bromobenzoyl)-3-methylpiperazin-1-yl]-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 42730899 |
| Molecular Formula | C26H30BrN5O2S |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-[4-(3-bromobenzoyl)-3-methylpiperazin-1-yl]-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
| SMILES | Cc1nnc(SCCCCC(=O)N2CCN(C(=O)c3cccc(Br)c3)C(C)C2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H30BrN5O2S/c1-19-18-30(14-15-31(19)25(34)21-9-8-10-22(27)17-21)24(33)13-6-7-16-35-26-29-28-20(2)32(26)23-11-4-3-5-12-23/h3-5,8-12,17,19H,6-7,13-16,18H2,1-2H3 |
| InChIKey | ZPKDWYNKIQTNTQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|