C33H37N5O3S — CID 42742727
1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 42742727) has the molecular formula C33H37N5O3S and a molecular weight of 583.76 g/mol. Its IUPAC name is 1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 42742727 |
| Molecular Formula | C33H37N5O3S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)CCCSc3nnc(-c4cccc(OC)c4)n3-c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C33H37N5O3S/c1-4-25-15-17-26(18-16-25)32(40)37-20-19-36(23-24(37)2)30(39)14-9-21-42-33-35-34-31(27-10-8-13-29(22-27)41-3)38(33)28-11-6-5-7-12-28/h5-8,10-13,15-18,22,24H,4,9,14,19-21,23H2,1-3H3 |
| InChIKey | PXXNANLCSMHXSS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|