C29H28N6O5S — CID 4592200
2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]ethanone (PubChem CID 4592200) has the molecular formula C29H28N6O5S and a molecular weight of 572.65 g/mol. Its IUPAC name is 2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4592200 |
| Molecular Formula | C29H28N6O5S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]ethanone |
| SMILES | COc1cccc(-c2nnc(SCC(=O)N3CCN(C(=O)c4cccc([N+](=O)[O-])c4)C(C)C3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H28N6O5S/c1-20-18-32(14-15-33(20)28(37)22-9-6-12-24(16-22)35(38)39)26(36)19-41-29-31-30-27(21-8-7-13-25(17-21)40-2)34(29)23-10-4-3-5-11-23/h3-13,16-17,20H,14-15,18-19H2,1-2H3 |
| InChIKey | RLENPTUQGBNHCH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|