C29H27ClN6O5S — CID 4018662
1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]-2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 4018662) has the molecular formula C29H27ClN6O5S and a molecular weight of 607.09 g/mol. Its IUPAC name is 1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]-2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]-2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 4018662 |
| Molecular Formula | C29H27ClN6O5S |
| Molecular Weight | 607.09 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | 1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]-2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | COc1cccc(-c2nnc(SCC(=O)N3CCN(C(=O)c4ccc([N+](=O)[O-])cc4Cl)C(C)C3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H27ClN6O5S/c1-19-17-33(13-14-34(19)28(38)24-12-11-22(36(39)40)16-25(24)30)26(37)18-42-29-32-31-27(20-7-6-10-23(15-20)41-2)35(29)21-8-4-3-5-9-21/h3-12,15-16,19H,13-14,17-18H2,1-2H3 |
| InChIKey | PYKZWNHJBCINOP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.09 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|