C32H33ClN6O5S — CID 42731571
4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]butan-1-one (PubChem CID 42731571) has the molecular formula C32H33ClN6O5S and a molecular weight of 649.17 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42731571 |
| Molecular Formula | C32H33ClN6O5S |
| Molecular Weight | 649.17 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 4-[[5-benzyl-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(2-chloro-4-nitrobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
| SMILES | COc1ccc(-n2c(Cc3ccccc3)nnc2SCCCC(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)C(C)C2)cc1 |
| InChI | InChI=1S/C32H33ClN6O5S/c1-22-21-36(16-17-37(22)31(41)27-15-12-25(39(42)43)20-28(27)33)30(40)9-6-18-45-32-35-34-29(19-23-7-4-3-5-8-23)38(32)24-10-13-26(44-2)14-11-24/h3-5,7-8,10-15,20,22H,6,9,16-19,21H2,1-2H3 |
| InChIKey | LREWAWFDPMKDRP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.17 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|