C26H24N6O4S2 — CID 3615666
1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]-2-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 3615666) has the molecular formula C26H24N6O4S2 and a molecular weight of 548.65 g/mol. Its IUPAC name is 1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]-2-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]-2-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 3615666 |
| Molecular Formula | C26H24N6O4S2 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]-2-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | CC1CN(C(=O)CSc2nnc(-c3cccs3)n2-c2ccccc2)CCN1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24N6O4S2/c1-18-16-29(12-13-30(18)25(34)19-7-5-10-21(15-19)32(35)36)23(33)17-38-26-28-27-24(22-11-6-14-37-22)31(26)20-8-3-2-4-9-20/h2-11,14-15,18H,12-13,16-17H2,1H3 |
| InChIKey | CUFOOSXAMLTDRZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|