C23H23ClN6O4S — CID 4006070
2-[[4-(3-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone (PubChem CID 4006070) has the molecular formula C23H23ClN6O4S and a molecular weight of 515.00 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[4-(3-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4006070 |
| Molecular Formula | C23H23ClN6O4S |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1nnc(SCC(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)C(C)C2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23ClN6O4S/c1-15-13-27(10-11-28(15)22(32)17-6-8-19(9-7-17)30(33)34)21(31)14-35-23-26-25-16(2)29(23)20-5-3-4-18(24)12-20/h3-9,12,15H,10-11,13-14H2,1-2H3 |
| InChIKey | LYVLYHWUCSMTHI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.00 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|