C37H45N5O2S — CID 3447285
4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 3447285) has the molecular formula C37H45N5O2S and a molecular weight of 623.87 g/mol. Its IUPAC name is 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3447285 |
| Molecular Formula | C37H45N5O2S |
| Molecular Weight | 623.87 g/mol |
| Exact Mass | 623.33 |
| IUPAC Name | 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(=O)CCCSc3nnc(-c4ccc(C)cc4)n3-c3ccc(C)cc3)CC2C)cc1 |
| InChI | InChI=1S/C37H45N5O2S/c1-5-6-7-9-30-15-19-32(20-16-30)36(44)41-24-23-40(26-29(41)4)34(43)10-8-25-45-37-39-38-35(31-17-11-27(2)12-18-31)42(37)33-21-13-28(3)14-22-33/h11-22,29H,5-10,23-26H2,1-4H3 |
| InChIKey | BMTYNNBIKMRLAB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.87 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|