C30H32N6O4S — CID 42742442
1-[4-(2-ethoxyphenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 42742442) has the molecular formula C30H32N6O4S and a molecular weight of 572.69 g/mol. Its IUPAC name is 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 42742442 |
| Molecular Formula | C30H32N6O4S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 1-[4-(2-ethoxyphenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | CCOc1ccccc1N1CCN(C(=O)CCCSc2nnc(-c3ccc([N+](=O)[O-])cc3)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C30H32N6O4S/c1-2-40-27-12-7-6-11-26(27)33-18-20-34(21-19-33)28(37)13-8-22-41-30-32-31-29(35(30)24-9-4-3-5-10-24)23-14-16-25(17-15-23)36(38)39/h3-7,9-12,14-17H,2,8,13,18-22H2,1H3 |
| InChIKey | FDKGKLXSQBSTFW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|