C28H27ClN6O3S — CID 42742441
1-[4-(2-chlorophenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 42742441) has the molecular formula C28H27ClN6O3S and a molecular weight of 563.08 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 42742441 |
| Molecular Formula | C28H27ClN6O3S |
| Molecular Weight | 563.08 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 1-[4-(2-chlorophenyl)piperazin-1-yl]-4-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H27ClN6O3S/c29-24-9-4-5-10-25(24)32-16-18-33(19-17-32)26(36)11-6-20-39-28-31-30-27(34(28)22-7-2-1-3-8-22)21-12-14-23(15-13-21)35(37)38/h1-5,7-10,12-15H,6,11,16-20H2 |
| InChIKey | RBVQFXSBZHNIKC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.08 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|