C31H35N5OS — CID 3473558
1-(4-benzylpiperazin-1-yl)-4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 3473558) has the molecular formula C31H35N5OS and a molecular weight of 525.72 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 3473558 |
| Molecular Formula | C31H35N5OS |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)N3CCN(Cc4ccccc4)CC3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H35N5OS/c1-24-10-14-27(15-11-24)30-32-33-31(36(30)28-16-12-25(2)13-17-28)38-22-6-9-29(37)35-20-18-34(19-21-35)23-26-7-4-3-5-8-26/h3-5,7-8,10-17H,6,9,18-23H2,1-2H3 |
| InChIKey | XBNKNTMFQYWRRH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|