C24H27Cl2N5OS — CID 42741272
4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methylpiperazin-1-yl)butan-1-one (PubChem CID 42741272) has the molecular formula C24H27Cl2N5OS and a molecular weight of 504.49 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 42741272 |
| Molecular Formula | C24H27Cl2N5OS |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methylpiperazin-1-yl)butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)c(Cl)c2)CCN1 |
| InChI | InChI=1S/C24H27Cl2N5OS/c1-17-16-30(12-11-27-17)23(32)8-5-13-33-24-29-28-22(14-18-6-3-2-4-7-18)31(24)19-9-10-20(25)21(26)15-19/h2-4,6-7,9-10,15,17,27H,5,8,11-14,16H2,1H3 |
| InChIKey | YZQZFBKFYFQHDY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|