C26H30ClN5O2S — CID 42742809
4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methyl-4-propanoylpiperazin-1-yl)butan-1-one (PubChem CID 42742809) has the molecular formula C26H30ClN5O2S and a molecular weight of 512.08 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methyl-4-propanoylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methyl-4-propanoylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 42742809 |
| Molecular Formula | C26H30ClN5O2S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methyl-4-propanoylpiperazin-1-yl)butan-1-one |
| SMILES | CCC(=O)N1CCN(C(=O)CCCSc2nnc(-c3ccccc3Cl)n2-c2ccccc2)CC1C |
| InChI | InChI=1S/C26H30ClN5O2S/c1-3-23(33)31-16-15-30(18-19(31)2)24(34)14-9-17-35-26-29-28-25(21-12-7-8-13-22(21)27)32(26)20-10-5-4-6-11-20/h4-8,10-13,19H,3,9,14-18H2,1-2H3 |
| InChIKey | MVKKEYZHIIHTDZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|