C30H31ClN4OS — CID 4004710
1-(4-benzylpiperidin-1-yl)-4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 4004710) has the molecular formula C30H31ClN4OS and a molecular weight of 531.13 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 4004710 |
| Molecular Formula | C30H31ClN4OS |
| Molecular Weight | 531.13 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2ccccc2Cl)n1-c1ccccc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H31ClN4OS/c31-27-15-8-7-14-26(27)29-32-33-30(35(29)25-12-5-2-6-13-25)37-21-9-16-28(36)34-19-17-24(18-20-34)22-23-10-3-1-4-11-23/h1-8,10-15,24H,9,16-22H2 |
| InChIKey | SBMHEEKKADYWLH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.13 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|