C26H31ClN4O2S — CID 16500901
1-(4-benzylpiperidin-1-yl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 16500901) has the molecular formula C26H31ClN4O2S and a molecular weight of 499.08 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 16500901 |
| Molecular Formula | C26H31ClN4O2S |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | COCCCn1c(SCC(=O)N2CCC(Cc3ccccc3)CC2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C26H31ClN4O2S/c1-33-17-7-14-31-25(22-10-5-6-11-23(22)27)28-29-26(31)34-19-24(32)30-15-12-21(13-16-30)18-20-8-3-2-4-9-20/h2-6,8-11,21H,7,12-19H2,1H3 |
| InChIKey | ILEWPXXKAUZPON-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|