C24H31ClN4O2S — CID 16500896
N-(1-adamantyl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16500896) has the molecular formula C24H31ClN4O2S and a molecular weight of 475.06 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16500896 |
| Molecular Formula | C24H31ClN4O2S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-(1-adamantyl)-2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCCn1c(SCC(=O)NC23CC4CC(CC(C4)C2)C3)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C24H31ClN4O2S/c1-31-8-4-7-29-22(19-5-2-3-6-20(19)25)27-28-23(29)32-15-21(30)26-24-12-16-9-17(13-24)11-18(10-16)14-24/h2-3,5-6,16-18H,4,7-15H2,1H3,(H,26,30) |
| InChIKey | QLBHYGSCLFEQRJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|