C19H20ClN5O3S2 — CID 16500863
2-[[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 16500863) has the molecular formula C19H20ClN5O3S2 and a molecular weight of 465.99 g/mol. Its IUPAC name is 2-[[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 16500863 |
| Molecular Formula | C19H20ClN5O3S2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-[[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | COCCCn1c(SCC(=O)Nc2sccc2C(N)=O)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN5O3S2/c1-28-9-4-8-25-17(12-5-2-3-6-14(12)20)23-24-19(25)30-11-15(26)22-18-13(16(21)27)7-10-29-18/h2-3,5-7,10H,4,8-9,11H2,1H3,(H2,21,27)(H,22,26) |
| InChIKey | NNWACDQXORVFEK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|