C21H23ClN4O4S2 — CID 24576925
N-[4-[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]phenyl]methanesulfonamide (PubChem CID 24576925) has the molecular formula C21H23ClN4O4S2 and a molecular weight of 495.03 g/mol. Its IUPAC name is N-[4-[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 24576925 |
| Molecular Formula | C21H23ClN4O4S2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[4-[2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]phenyl]methanesulfonamide |
| SMILES | COCCCn1c(SCC(=O)c2ccc(NS(C)(=O)=O)cc2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H23ClN4O4S2/c1-30-13-5-12-26-20(17-6-3-4-7-18(17)22)23-24-21(26)31-14-19(27)15-8-10-16(11-9-15)25-32(2,28)29/h3-4,6-11,25H,5,12-14H2,1-2H3 |
| InChIKey | NUCBOKUMHPRHSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|