C19H27ClN4O2S — CID 46677183
2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)propanamide (PubChem CID 46677183) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 46677183 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)propanamide |
| SMILES | COCCCn1c(SC(C)C(=O)NCC(C)C)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN4O2S/c1-13(2)12-21-18(25)14(3)27-19-23-22-17(24(19)10-7-11-26-4)15-8-5-6-9-16(15)20/h5-6,8-9,13-14H,7,10-12H2,1-4H3,(H,21,25) |
| InChIKey | BBGCQMWDMGQKJG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|