C22H24ClN5O3S — CID 24566771
2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide (PubChem CID 24566771) has the molecular formula C22H24ClN5O3S and a molecular weight of 473.99 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 24566771 |
| Molecular Formula | C22H24ClN5O3S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(phenylcarbamoyl)propanamide |
| SMILES | COCCCn1c(SC(C)C(=O)NC(=O)Nc2ccccc2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C22H24ClN5O3S/c1-15(20(29)25-21(30)24-16-9-4-3-5-10-16)32-22-27-26-19(28(22)13-8-14-31-2)17-11-6-7-12-18(17)23/h3-7,9-12,15H,8,13-14H2,1-2H3,(H2,24,25,29,30) |
| InChIKey | FIJPODPULKOTLI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|