C16H20ClN5O3S — CID 2459970
(2R)-N-carbamoyl-2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 2459970) has the molecular formula C16H20ClN5O3S and a molecular weight of 397.89 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-carbamoyl-2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 2459970 |
| Molecular Formula | C16H20ClN5O3S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (2R)-N-carbamoyl-2-[[5-(4-chlorophenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COCCCn1c(S[C@H](C)C(=O)NC(N)=O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN5O3S/c1-10(14(23)19-15(18)24)26-16-21-20-13(22(16)8-3-9-25-2)11-4-6-12(17)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H3,18,19,23,24)/t10-/m1/s1 |
| InChIKey | SGNUCOHDKUDROV-SNVBAGLBSA-N |
| XLogP | 2.31 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|