C21H25ClN6OS — CID 55498320
2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylpropanamide (PubChem CID 55498320) has the molecular formula C21H25ClN6OS and a molecular weight of 444.99 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylpropanamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylpropanamide |
|---|---|
| PubChem CID | 55498320 |
| Molecular Formula | C21H25ClN6OS |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylpropanamide |
| SMILES | CCCCCCn1c(SC(C)C(=O)Nc2ncccn2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN6OS/c1-3-4-5-6-14-28-18(16-8-10-17(22)11-9-16)26-27-21(28)30-15(2)19(29)25-20-23-12-7-13-24-20/h7-13,15H,3-6,14H2,1-2H3,(H,23,24,25,29) |
| InChIKey | WNYGQEMVFRUJRM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|