C18H15Cl2N5O2S2 — CID 4843784
2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 4843784) has the molecular formula C18H15Cl2N5O2S2 and a molecular weight of 468.39 g/mol. Its IUPAC name is 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4843784 |
| Molecular Formula | C18H15Cl2N5O2S2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sccc2C(N)=O)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N5O2S2/c1-2-6-25-16(11-4-3-10(19)8-13(11)20)23-24-18(25)29-9-14(26)22-17-12(15(21)27)5-7-28-17/h2-5,7-8H,1,6,9H2,(H2,21,27)(H,22,26) |
| InChIKey | NIGVMZVHKWMBOB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|