C26H22Cl2N4O3S2 — CID 19729039
ethyl 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19729039) has the molecular formula C26H22Cl2N4O3S2 and a molecular weight of 573.53 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19729039 |
| Molecular Formula | C26H22Cl2N4O3S2 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | ethyl 2-[[2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccccc3)c2C(=O)OCC)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H22Cl2N4O3S2/c1-3-12-32-23(18-11-10-17(27)13-20(18)28)30-31-26(32)37-15-21(33)29-24-22(25(34)35-4-2)19(14-36-24)16-8-6-5-7-9-16/h3,5-11,13-14H,1,4,12,15H2,2H3,(H,29,33) |
| InChIKey | ZMOWDMGSWFNHNC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|