C26H23ClN4O3S2 — CID 19729905
methyl 4-(4-chlorophenyl)-2-[[2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19729905) has the molecular formula C26H23ClN4O3S2 and a molecular weight of 539.08 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19729905 |
| Molecular Formula | C26H23ClN4O3S2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)OC)nnc1-c1ccccc1C |
| InChI | InChI=1S/C26H23ClN4O3S2/c1-4-13-31-23(19-8-6-5-7-16(19)2)29-30-26(31)36-15-21(32)28-24-22(25(33)34-3)20(14-35-24)17-9-11-18(27)12-10-17/h4-12,14H,1,13,15H2,2-3H3,(H,28,32) |
| InChIKey | YKNWFDLOPIGSSC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|