C26H25ClN4O3S3 — CID 19719514
methyl 4-(4-chlorophenyl)-2-[[2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19719514) has the molecular formula C26H25ClN4O3S3 and a molecular weight of 573.17 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19719514 |
| Molecular Formula | C26H25ClN4O3S3 |
| Molecular Weight | 573.17 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)OC)nnc1-c1csc(CCC)c1 |
| InChI | InChI=1S/C26H25ClN4O3S3/c1-4-6-19-12-17(13-35-19)23-29-30-26(31(23)11-5-2)37-15-21(32)28-24-22(25(33)34-3)20(14-36-24)16-7-9-18(27)10-8-16/h5,7-10,12-14H,2,4,6,11,15H2,1,3H3,(H,28,32) |
| InChIKey | IAGQYYZDYYVABC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.17 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|