C29H30N4O7S2 — CID 19731412
methyl 4-(4-methoxyphenyl)-2-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19731412) has the molecular formula C29H30N4O7S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is methyl 4-(4-methoxyphenyl)-2-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-methoxyphenyl)-2-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19731412 |
| Molecular Formula | C29H30N4O7S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | methyl 4-(4-methoxyphenyl)-2-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(OC)cc3)c2C(=O)OC)nnc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H30N4O7S2/c1-7-12-33-26(18-13-21(37-3)25(39-5)22(14-18)38-4)31-32-29(33)42-16-23(34)30-27-24(28(35)40-6)20(15-41-27)17-8-10-19(36-2)11-9-17/h7-11,13-15H,1,12,16H2,2-6H3,(H,30,34) |
| InChIKey | BRTQJNFPACEHJM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|