C25H28N4O8S2 — CID 19731399
dimethyl 3-methyl-5-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 19731399) has the molecular formula C25H28N4O8S2 and a molecular weight of 576.65 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19731399 |
| Molecular Formula | C25H28N4O8S2 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | dimethyl 3-methyl-5-[[2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc(C(=O)OC)c(C)c2C(=O)OC)nnc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H28N4O8S2/c1-8-9-29-21(14-10-15(33-3)19(35-5)16(11-14)34-4)27-28-25(29)38-12-17(30)26-22-18(23(31)36-6)13(2)20(39-22)24(32)37-7/h8,10-11H,1,9,12H2,2-7H3,(H,26,30) |
| InChIKey | SLOWPGZTDZFSTQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|