C24H28N4O5S — CID 19213186
N-(4-ethoxyphenyl)-2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19213186) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19213186 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[4-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(OCC)cc2)nnc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O5S/c1-6-12-28-23(16-13-19(30-3)22(32-5)20(14-16)31-4)26-27-24(28)34-15-21(29)25-17-8-10-18(11-9-17)33-7-2/h6,8-11,13-14H,1,7,12,15H2,2-5H3,(H,25,29) |
| InChIKey | VCWLZVJRNWVUCI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|