C21H24N4O2S2 — CID 19721089
2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 19721089) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19721089 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(OCC)cc2)nnc1-c1csc(C)c1C |
| InChI | InChI=1S/C21H24N4O2S2/c1-5-11-25-20(18-12-28-15(4)14(18)3)23-24-21(25)29-13-19(26)22-16-7-9-17(10-8-16)27-6-2/h5,7-10,12H,1,6,11,13H2,2-4H3,(H,22,26) |
| InChIKey | KDGRRGAPROMXSE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|