C27H25ClN4O5S2 — CID 19731108
methyl 4-(4-chlorophenyl)-2-[[2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19731108) has the molecular formula C27H25ClN4O5S2 and a molecular weight of 585.11 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19731108 |
| Molecular Formula | C27H25ClN4O5S2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-(3,4-dimethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)OC)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H25ClN4O5S2/c1-5-12-32-24(17-8-11-20(35-2)21(13-17)36-3)30-31-27(32)39-15-22(33)29-25-23(26(34)37-4)19(14-38-25)16-6-9-18(28)10-7-16/h5-11,13-14H,1,12,15H2,2-4H3,(H,29,33) |
| InChIKey | TXCKKWCQASLQJU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|