C28H26Cl2N4O4S2 — CID 19638431
methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19638431) has the molecular formula C28H26Cl2N4O4S2 and a molecular weight of 617.58 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19638431 |
| Molecular Formula | C28H26Cl2N4O4S2 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(C)cc3)c2C(=O)OC)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C28H26Cl2N4O4S2/c1-5-12-34-25(17(3)38-22-13-19(29)10-11-21(22)30)32-33-28(34)40-15-23(35)31-26-24(27(36)37-4)20(14-39-26)18-8-6-16(2)7-9-18/h5-11,13-14,17H,1,12,15H2,2-4H3,(H,31,35) |
| InChIKey | CEHJSPKMJGWANG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|