C28H26Cl2N4O5S2 — CID 19638435
methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19638435) has the molecular formula C28H26Cl2N4O5S2 and a molecular weight of 633.58 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19638435 |
| Molecular Formula | C28H26Cl2N4O5S2 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | methyl 2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(OC)cc3)c2C(=O)OC)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C28H26Cl2N4O5S2/c1-5-12-34-25(16(2)39-22-13-18(29)8-11-21(22)30)32-33-28(34)41-15-23(35)31-26-24(27(36)38-4)20(14-40-26)17-6-9-19(37-3)10-7-17/h5-11,13-14,16H,1,12,15H2,2-4H3,(H,31,35) |
| InChIKey | INFJUNYCCKXKCX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|